C28H40F2N2O5 — CID 68814268
tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-(3-methylbut-2-enoxy)pyrrolidine-1-carboxylate (PubChem CID 68814268) has the molecular formula C28H40F2N2O5 and a molecular weight of 522.63 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-(3-methylbut-2-enoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-(3-methylbut-2-enoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68814268 |
| Molecular Formula | C28H40F2N2O5 |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-(3-methylbut-2-enoxy)pyrrolidine-1-carboxylate |
| SMILES | CC(=O)N1[C@@H](Cc2cc(F)cc(F)c2)[C@@H]([C@H]2C[C@@H](OCC=C(C)C)CN2C(=O)OC(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C28H40F2N2O5/c1-17(2)9-10-35-22-15-23(31(16-22)26(34)37-27(4,5)6)25-24(32(18(3)33)28(7,8)36-25)13-19-11-20(29)14-21(30)12-19/h9,11-12,14,22-25H,10,13,15-16H2,1-8H3/t22-,23-,24+,25-/m1/s1 |
| InChIKey | NZJDESYHJATLKJ-ZKGSSEMHSA-N |
| XLogP | 5.22 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|