C30H38F2N2O5 — CID 68814284
tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-phenylmethoxypyrrolidine-1-carboxylate (PubChem CID 68814284) has the molecular formula C30H38F2N2O5 and a molecular weight of 544.64 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-phenylmethoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-phenylmethoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68814284 |
| Molecular Formula | C30H38F2N2O5 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | tert-butyl (2R,4R)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-phenylmethoxypyrrolidine-1-carboxylate |
| SMILES | CC(=O)N1[C@@H](Cc2cc(F)cc(F)c2)[C@@H]([C@H]2C[C@@H](OCc3ccccc3)CN2C(=O)OC(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C30H38F2N2O5/c1-19(35)34-26(14-21-12-22(31)15-23(32)13-21)27(38-30(34,5)6)25-16-24(37-18-20-10-8-7-9-11-20)17-33(25)28(36)39-29(2,3)4/h7-13,15,24-27H,14,16-18H2,1-6H3/t24-,25-,26+,27-/m1/s1 |
| InChIKey | LZYRZSVYMUULAG-JVYGEBFASA-N |
| XLogP | 5.45 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |