C18H27FN2O3 — CID 68814429
tert-butyl 2-(2-amino-1-hydroxy-3-phenylpropyl)-3-fluoropyrrolidine-1-carboxylate (PubChem CID 68814429) has the molecular formula C18H27FN2O3 and a molecular weight of 338.42 g/mol. Its IUPAC name is tert-butyl 2-(2-amino-1-hydroxy-3-phenylpropyl)-3-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-amino-1-hydroxy-3-phenylpropyl)-3-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68814429 |
| Molecular Formula | C18H27FN2O3 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | tert-butyl 2-(2-amino-1-hydroxy-3-phenylpropyl)-3-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)C1C(O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C18H27FN2O3/c1-18(2,3)24-17(23)21-10-9-13(19)15(21)16(22)14(20)11-12-7-5-4-6-8-12/h4-8,13-16,22H,9-11,20H2,1-3H3 |
| InChIKey | KKJDHKPIWIYSKQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |