About 2H-1,6-naphthyridin-3-one
2H-1,6-naphthyridin-3-one (PubChem CID 68814964) has the molecular formula C8H6N2O
and a molecular weight of 146.15 g/mol. Its IUPAC name is 2H-1,6-naphthyridin-3-one.
Molecular Properties
| Compound Name | 2H-1,6-naphthyridin-3-one |
| PubChem CID | 68814964 |
| Molecular Formula | C8H6N2O |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 2H-1,6-naphthyridin-3-one |
| SMILES | O=C1C=c2cnccc2=NC1 |
| InChI | InChI=1S/C8H6N2O/c11-7-3-6-4-9-2-1-8(6)10-5-7/h1-4H,5H2 |
| InChIKey | NWDCYFWGKMQANH-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-1,6-naphthyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,6-naphthyridin-3-one?
The IUPAC name of 2H-1,6-naphthyridin-3-one (CID 68814964) is 2H-1,6-naphthyridin-3-one.
What is the SMILES notation for 2H-1,6-naphthyridin-3-one?
The canonical SMILES for 2H-1,6-naphthyridin-3-one is O=C1C=c2cnccc2=NC1.
What is the InChIKey of 2H-1,6-naphthyridin-3-one?
The InChIKey is NWDCYFWGKMQANH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O/c11-7-3-6-4-9-2-1-8(6)10-5-7/h1-4H,5H2.
What are the key properties of 2H-1,6-naphthyridin-3-one?
2H-1,6-naphthyridin-3-one has a molecular weight of 146.15 g/mol, XLogP of -0.94, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,6-naphthyridin-3-one is sourced from PubChem (CID 68814964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).