About 10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid
10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid (PubChem CID 68815107) has the molecular formula C21H14F3NO2
and a molecular weight of 369.34 g/mol. Its IUPAC name is 10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid.
Molecular Properties
| Compound Name | 10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid |
| PubChem CID | 68815107 |
| Molecular Formula | C21H14F3NO2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid |
| SMILES | CN1c2ccccc2C(C(=O)O)c2ccc(-c3ccc(F)c(F)c3F)cc21 |
| InChI | InChI=1S/C21H14F3NO2/c1-25-16-5-3-2-4-13(16)18(21(26)27)14-7-6-11(10-17(14)25)12-8-9-15(22)20(24)19(12)23/h2-10,18H,1H3,(H,26,27) |
| InChIKey | DETYATGWFWOCNG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid?
The IUPAC name of 10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid (CID 68815107) is 10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid.
What is the SMILES notation for 10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid?
The canonical SMILES for 10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid is CN1c2ccccc2C(C(=O)O)c2ccc(-c3ccc(F)c(F)c3F)cc21.
What is the InChIKey of 10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid?
The InChIKey is DETYATGWFWOCNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14F3NO2/c1-25-16-5-3-2-4-13(16)18(21(26)27)14-7-6-11(10-17(14)25)12-8-9-15(22)20(24)19(12)23/h2-10,18H,1H3,(H,26,27).
What are the key properties of 10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid?
10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid has a molecular weight of 369.34 g/mol, XLogP of 5.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-3-(2,3,4-trifluorophenyl)-9H-acridine-9-carboxylic acid is sourced from PubChem (CID 68815107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).