About (2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone
(2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone (PubChem CID 68815126) has the molecular formula C20H15BF4O3
and a molecular weight of 390.14 g/mol. Its IUPAC name is (2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone.
Molecular Properties
| Compound Name | (2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone |
| PubChem CID | 68815126 |
| Molecular Formula | C20H15BF4O3 |
| Molecular Weight | 390.14 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1-c1ccc(F)cc1F.OB(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H10F2O.C6H5BF2O2/c1-9(17)11-4-2-3-5-12(11)13-7-6-10(15)8-14(13)16;8-4-1-2-5(7(10)11)6(9)3-4/h2-8H,1H3;1-3,10-11H |
| InChIKey | GKIHZXYJTYQREE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.14 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone?
The IUPAC name of (2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone (CID 68815126) is (2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone.
What is the SMILES notation for (2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone?
The canonical SMILES for (2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone is CC(=O)c1ccccc1-c1ccc(F)cc1F.OB(O)c1ccc(F)cc1F.
What is the InChIKey of (2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone?
The InChIKey is GKIHZXYJTYQREE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2O.C6H5BF2O2/c1-9(17)11-4-2-3-5-12(11)13-7-6-10(15)8-14(13)16;8-4-1-2-5(7(10)11)6(9)3-4/h2-8H,1H3;1-3,10-11H.
What are the key properties of (2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone?
(2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone has a molecular weight of 390.14 g/mol, XLogP of 3.48, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-difluorophenyl)boronic acid;1-[2-(2,4-difluorophenyl)phenyl]ethanone is sourced from PubChem (CID 68815126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).