About 1,1,2-tributyl-3,4-dimethylsilole
1,1,2-tributyl-3,4-dimethylsilole (PubChem CID 68815519) has the molecular formula C18H34Si
and a molecular weight of 278.56 g/mol. Its IUPAC name is 1,1,2-tributyl-3,4-dimethylsilole.
Molecular Properties
| Compound Name | 1,1,2-tributyl-3,4-dimethylsilole |
| PubChem CID | 68815519 |
| Molecular Formula | C18H34Si |
| Molecular Weight | 278.56 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 1,1,2-tributyl-3,4-dimethylsilole |
| SMILES | CCCCC1=C(C)C(C)=C[Si]1(CCCC)CCCC |
| InChI | InChI=1S/C18H34Si/c1-6-9-12-18-17(5)16(4)15-19(18,13-10-7-2)14-11-8-3/h15H,6-14H2,1-5H3 |
| InChIKey | XZFGSOAHHCKBSI-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.56 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2-tributyl-3,4-dimethylsilole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-tributyl-3,4-dimethylsilole?
The IUPAC name of 1,1,2-tributyl-3,4-dimethylsilole (CID 68815519) is 1,1,2-tributyl-3,4-dimethylsilole.
What is the SMILES notation for 1,1,2-tributyl-3,4-dimethylsilole?
The canonical SMILES for 1,1,2-tributyl-3,4-dimethylsilole is CCCCC1=C(C)C(C)=C[Si]1(CCCC)CCCC.
What is the InChIKey of 1,1,2-tributyl-3,4-dimethylsilole?
The InChIKey is XZFGSOAHHCKBSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34Si/c1-6-9-12-18-17(5)16(4)15-19(18,13-10-7-2)14-11-8-3/h15H,6-14H2,1-5H3.
What are the key properties of 1,1,2-tributyl-3,4-dimethylsilole?
1,1,2-tributyl-3,4-dimethylsilole has a molecular weight of 278.56 g/mol, XLogP of 6.58, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-tributyl-3,4-dimethylsilole is sourced from PubChem (CID 68815519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).