C27H24F4N6O3 — CID 68815786
3-[(5-ethyl-2-fluorophenyl)-[5-(furan-3-yl)-2-methyl-1,2,4-triazol-3-yl]methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid (PubChem CID 68815786) has the molecular formula C27H24F4N6O3 and a molecular weight of 556.52 g/mol. Its IUPAC name is 3-[(5-ethyl-2-fluorophenyl)-[5-(furan-3-yl)-2-methyl-1,2,4-triazol-3-yl]methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(5-ethyl-2-fluorophenyl)-[5-(furan-3-yl)-2-methyl-1,2,4-triazol-3-yl]methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68815786 |
| Molecular Formula | C27H24F4N6O3 |
| Molecular Weight | 556.52 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 3-[(5-ethyl-2-fluorophenyl)-[5-(furan-3-yl)-2-methyl-1,2,4-triazol-3-yl]methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid |
| SMILES | CCc1ccc(F)c(C(c2cc3cc(N)ccc3c(N)n2)c2nc(-c3ccoc3)nn2C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H23FN6O.C2HF3O2/c1-3-14-4-7-20(26)19(10-14)22(25-30-24(31-32(25)2)15-8-9-33-13-15)21-12-16-11-17(27)5-6-18(16)23(28)29-21;3-2(4,5)1(6)7/h4-13,22H,3,27H2,1-2H3,(H2,28,29);(H,6,7) |
| InChIKey | USOHSEGHZNSKAL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 146.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|