C9H11NO5 — CID 688158
(1S,2R)-1-(4-nitrophenyl)propane-1,2,3-triol (PubChem CID 688158) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is (1S,2R)-1-(4-nitrophenyl)propane-1,2,3-triol.
| Compound Name | (1S,2R)-1-(4-nitrophenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 688158 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (1S,2R)-1-(4-nitrophenyl)propane-1,2,3-triol |
| SMILES | O=[N+]([O-])c1ccc([C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C9H11NO5/c11-5-8(12)9(13)6-1-3-7(4-2-6)10(14)15/h1-4,8-9,11-13H,5H2/t8-,9+/m1/s1 |
| InChIKey | IUZVZBIQZKBWCC-BDAKNGLRSA-N |
| XLogP | -0.02 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|