C26H34F2N2O6 — CID 68816169
tert-butyl (2R,4E)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-(2-methoxy-2-oxoethylidene)pyrrolidine-1-carboxylate (PubChem CID 68816169) has the molecular formula C26H34F2N2O6 and a molecular weight of 508.56 g/mol. Its IUPAC name is tert-butyl (2R,4E)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-(2-methoxy-2-oxoethylidene)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4E)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-(2-methoxy-2-oxoethylidene)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68816169 |
| Molecular Formula | C26H34F2N2O6 |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | tert-butyl (2R,4E)-2-[(4S,5S)-3-acetyl-4-[(3,5-difluorophenyl)methyl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-4-(2-methoxy-2-oxoethylidene)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)/C=C1\C[C@H]([C@H]2OC(C)(C)N(C(C)=O)[C@H]2Cc2cc(F)cc(F)c2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C26H34F2N2O6/c1-15(31)30-21(10-16-8-18(27)13-19(28)9-16)23(35-26(30,5)6)20-11-17(12-22(32)34-7)14-29(20)24(33)36-25(2,3)4/h8-9,12-13,20-21,23H,10-11,14H2,1-7H3/b17-12+/t20-,21+,23-/m1/s1 |
| InChIKey | VURAGNYQVQNUHU-LNNLBKKZSA-N |
| XLogP | 3.97 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|