About 6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one
6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one (PubChem CID 68816242) has the molecular formula C6H3FN2OS
and a molecular weight of 170.17 g/mol. Its IUPAC name is 6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one.
Molecular Properties
| Compound Name | 6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one |
| PubChem CID | 68816242 |
| Molecular Formula | C6H3FN2OS |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | 6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one |
| SMILES | O=c1[nH]c2cc(F)cnc2s1 |
| InChI | InChI=1S/C6H3FN2OS/c7-3-1-4-5(8-2-3)11-6(10)9-4/h1-2H,(H,9,10) |
| InChIKey | RBQQVRPMKDFODT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one?
The IUPAC name of 6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one (CID 68816242) is 6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one.
What is the SMILES notation for 6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one?
The canonical SMILES for 6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one is O=c1[nH]c2cc(F)cnc2s1.
What is the InChIKey of 6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one?
The InChIKey is RBQQVRPMKDFODT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3FN2OS/c7-3-1-4-5(8-2-3)11-6(10)9-4/h1-2H,(H,9,10).
What are the key properties of 6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one?
6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one has a molecular weight of 170.17 g/mol, XLogP of 1.12, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1H-[1,3]thiazolo[5,4-b]pyridin-2-one is sourced from PubChem (CID 68816242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).