C19H21FN2S — CID 68816852
(4aR,9bR)-6-(4-fluorophenyl)sulfanyl-2,5-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 68816852) has the molecular formula C19H21FN2S and a molecular weight of 328.46 g/mol. Its IUPAC name is (4aR,9bR)-6-(4-fluorophenyl)sulfanyl-2,5-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | (4aR,9bR)-6-(4-fluorophenyl)sulfanyl-2,5-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 68816852 |
| Molecular Formula | C19H21FN2S |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (4aR,9bR)-6-(4-fluorophenyl)sulfanyl-2,5-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | CN1CC[C@@H]2[C@@H](C1)c1cccc(Sc3ccc(F)cc3)c1N2C |
| InChI | InChI=1S/C19H21FN2S/c1-21-11-10-17-16(12-21)15-4-3-5-18(19(15)22(17)2)23-14-8-6-13(20)7-9-14/h3-9,16-17H,10-12H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | PVWPOPRIMNSBDG-DLBZAZTESA-N |
| XLogP | 4.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |