About 2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole
2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole (PubChem CID 68817061) has the molecular formula C27H20N2OS
and a molecular weight of 420.54 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole |
| PubChem CID | 68817061 |
| Molecular Formula | C27H20N2OS |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole |
| SMILES | Cc1ccccc1-c1nc2ccccc2s1.c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C14H11NS.C13H9NO/c1-10-6-2-3-7-11(10)14-15-12-8-4-5-9-13(12)16-14;1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h2-9H,1H3;1-9H |
| InChIKey | HBAYTFABCYWGOD-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole?
The IUPAC name of 2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole (CID 68817061) is 2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole.
What is the SMILES notation for 2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole?
The canonical SMILES for 2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole is Cc1ccccc1-c1nc2ccccc2s1.c1ccc(-c2nc3ccccc3o2)cc1.
What is the InChIKey of 2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole?
The InChIKey is HBAYTFABCYWGOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NS.C13H9NO/c1-10-6-2-3-7-11(10)14-15-12-8-4-5-9-13(12)16-14;1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h2-9H,1H3;1-9H.
What are the key properties of 2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole?
2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole has a molecular weight of 420.54 g/mol, XLogP of 7.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylphenyl)-1,3-benzothiazole;2-phenyl-1,3-benzoxazole is sourced from PubChem (CID 68817061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).