About bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine
bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine (PubChem CID 68817533) has the molecular formula C10H9F3N4S
and a molecular weight of 274.27 g/mol. Its IUPAC name is bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine.
Molecular Properties
| Compound Name | bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine |
| PubChem CID | 68817533 |
| Molecular Formula | C10H9F3N4S |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine |
| SMILES | C#N.C#N.NN=Cc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C8H7F3N2S.2CHN/c9-8(10,11)14-7-3-1-6(2-4-7)5-13-12;2*1-2/h1-5H,12H2;2*1H |
| InChIKey | UYBOCXHPSFHBBG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine?
The IUPAC name of bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine (CID 68817533) is bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine.
What is the SMILES notation for bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine?
The canonical SMILES for bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine is C#N.C#N.NN=Cc1ccc(SC(F)(F)F)cc1.
What is the InChIKey of bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine?
The InChIKey is UYBOCXHPSFHBBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3N2S.2CHN/c9-8(10,11)14-7-3-1-6(2-4-7)5-13-12;2*1-2/h1-5H,12H2;2*1H.
What are the key properties of bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine?
bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine has a molecular weight of 274.27 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(formonitrile);[4-(trifluoromethylsulfanyl)phenyl]methylidenehydrazine is sourced from PubChem (CID 68817533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).