C26H20BNO2 — CID 68817582
[4-(2,3-diphenylindol-1-yl)phenyl]boronic acid (PubChem CID 68817582) has the molecular formula C26H20BNO2 and a molecular weight of 389.26 g/mol. Its IUPAC name is [4-(2,3-diphenylindol-1-yl)phenyl]boronic acid.
| Compound Name | [4-(2,3-diphenylindol-1-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 68817582 |
| Molecular Formula | C26H20BNO2 |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [4-(2,3-diphenylindol-1-yl)phenyl]boronic acid |
| SMILES | OB(O)c1ccc(-n2c(-c3ccccc3)c(-c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H20BNO2/c29-27(30)21-15-17-22(18-16-21)28-24-14-8-7-13-23(24)25(19-9-3-1-4-10-19)26(28)20-11-5-2-6-12-20/h1-18,29-30H |
| InChIKey | CPPKMAGPVXWMNT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|