C14H7ClF2O5 — CID 68818087
(2-hydroxyphenyl) 6-chloro-2,2-difluoro-1,3-benzodioxole-5-carboxylate (PubChem CID 68818087) has the molecular formula C14H7ClF2O5 and a molecular weight of 328.65 g/mol. Its IUPAC name is (2-hydroxyphenyl) 6-chloro-2,2-difluoro-1,3-benzodioxole-5-carboxylate.
| Compound Name | (2-hydroxyphenyl) 6-chloro-2,2-difluoro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 68818087 |
| Molecular Formula | C14H7ClF2O5 |
| Molecular Weight | 328.65 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | (2-hydroxyphenyl) 6-chloro-2,2-difluoro-1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(Oc1ccccc1O)c1cc2c(cc1Cl)OC(F)(F)O2 |
| InChI | InChI=1S/C14H7ClF2O5/c15-8-6-12-11(21-14(16,17)22-12)5-7(8)13(19)20-10-4-2-1-3-9(10)18/h1-6,18H |
| InChIKey | RZHUZRJGQXHGRK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.65 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|