About 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylic acid
1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylic acid (PubChem CID 688186) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylic acid.
Analyze 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylic acid?
The IUPAC name of 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylic acid (CID 688186) is 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylic acid.
What is the SMILES notation for 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylic acid?
The canonical SMILES for 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylic acid is CC1(C)CC(C(=O)O)CC(C)(C)N1O.
What is the InChIKey of 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylic acid?
The InChIKey is GVQKWFQBWZOJHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-9(2)5-7(8(12)13)6-10(3,4)11(9)14/h7,14H,5-6H2,1-4H3,(H,12,13).
What are the key properties of 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylic acid?
1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylic acid has a molecular weight of 201.27 g/mol, XLogP of 1.73, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylic acid is sourced from PubChem (CID 688186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).