C20H26ClN3O5 — CID 68818934
[2-methyl-4-[(1R)-1-(methylamino)-3-(4-nitrophenoxy)propyl]phenyl] N,N-dimethylcarbamate;hydrochloride (PubChem CID 68818934) has the molecular formula C20H26ClN3O5 and a molecular weight of 423.90 g/mol. Its IUPAC name is [2-methyl-4-[(1R)-1-(methylamino)-3-(4-nitrophenoxy)propyl]phenyl] N,N-dimethylcarbamate;hydrochloride.
| Compound Name | [2-methyl-4-[(1R)-1-(methylamino)-3-(4-nitrophenoxy)propyl]phenyl] N,N-dimethylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 68818934 |
| Molecular Formula | C20H26ClN3O5 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [2-methyl-4-[(1R)-1-(methylamino)-3-(4-nitrophenoxy)propyl]phenyl] N,N-dimethylcarbamate;hydrochloride |
| SMILES | CN[C@H](CCOc1ccc([N+](=O)[O-])cc1)c1ccc(OC(=O)N(C)C)c(C)c1.Cl |
| InChI | InChI=1S/C20H25N3O5.ClH/c1-14-13-15(5-10-19(14)28-20(24)22(3)4)18(21-2)11-12-27-17-8-6-16(7-9-17)23(25)26;/h5-10,13,18,21H,11-12H2,1-4H3;1H/t18-;/m1./s1 |
| InChIKey | AZMQZDWXOQLTDY-GMUIIQOCSA-N |
| XLogP | 4.12 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|