C16H18N2O — CID 68819505
benzamide;1,2,3,4-tetrahydroquinoline (PubChem CID 68819505) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is benzamide;1,2,3,4-tetrahydroquinoline.
| Compound Name | benzamide;1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 68819505 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | benzamide;1,2,3,4-tetrahydroquinoline |
| SMILES | NC(=O)c1ccccc1.c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C9H11N.C7H7NO/c1-2-6-9-8(4-1)5-3-7-10-9;8-7(9)6-4-2-1-3-5-6/h1-2,4,6,10H,3,5,7H2;1-5H,(H2,8,9) |
| InChIKey | JWFVENKOKBOPBO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |