About N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine
N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine (PubChem CID 68819866) has the molecular formula C14H13N
and a molecular weight of 195.26 g/mol. Its IUPAC name is N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine.
Molecular Properties
| Compound Name | N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine |
| PubChem CID | 68819866 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine |
| SMILES | c1ccc(CNC2c3ccccc32)cc1 |
| InChI | InChI=1S/C14H13N/c1-2-6-11(7-3-1)10-15-14-12-8-4-5-9-13(12)14/h1-9,14-15H,10H2 |
| InChIKey | HJEKCEGQBKIGHO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine?
The IUPAC name of N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine (CID 68819866) is N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine.
What is the SMILES notation for N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine?
The canonical SMILES for N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine is c1ccc(CNC2c3ccccc32)cc1.
What is the InChIKey of N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine?
The InChIKey is HJEKCEGQBKIGHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N/c1-2-6-11(7-3-1)10-15-14-12-8-4-5-9-13(12)14/h1-9,14-15H,10H2.
What are the key properties of N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine?
N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine has a molecular weight of 195.26 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylbicyclo[4.1.0]hepta-1,3,5-trien-7-amine is sourced from PubChem (CID 68819866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).