About ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate
ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate (PubChem CID 68820098) has the molecular formula C14H26O5
and a molecular weight of 274.36 g/mol. Its IUPAC name is ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate.
Molecular Properties
| Compound Name | ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate |
| PubChem CID | 68820098 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate |
| SMILES | CCOC(=O)C[C@](O)(C(C)C)C1CCOC(C)(C)O1 |
| InChI | InChI=1S/C14H26O5/c1-6-17-12(15)9-14(16,10(2)3)11-7-8-18-13(4,5)19-11/h10-11,16H,6-9H2,1-5H3/t11?,14-/m0/s1 |
| InChIKey | KHUPRJWRMWLBQV-IAXJKZSUSA-N |
| XLogP | 1.87 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate?
The IUPAC name of ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate (CID 68820098) is ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate.
What is the SMILES notation for ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate?
The canonical SMILES for ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate is CCOC(=O)C[C@](O)(C(C)C)C1CCOC(C)(C)O1.
What is the InChIKey of ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate?
The InChIKey is KHUPRJWRMWLBQV-IAXJKZSUSA-N. The full InChI is InChI=1S/C14H26O5/c1-6-17-12(15)9-14(16,10(2)3)11-7-8-18-13(4,5)19-11/h10-11,16H,6-9H2,1-5H3/t11?,14-/m0/s1.
What are the key properties of ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate?
ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate has a molecular weight of 274.36 g/mol, XLogP of 1.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate is sourced from PubChem (CID 68820098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).