About 1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol
1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol (PubChem CID 68820227) has the molecular formula C14H14F3N3O
and a molecular weight of 297.28 g/mol. Its IUPAC name is 1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol.
Molecular Properties
| Compound Name | 1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol |
| PubChem CID | 68820227 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol |
| SMILES | CCc1cc(NC(C)O)nc(-c2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C14H14F3N3O/c1-3-9-6-12(18-7(2)21)20-14(19-9)8-4-10(15)13(17)11(16)5-8/h4-7,21H,3H2,1-2H3,(H,18,19,20) |
| InChIKey | FFEMXRJYVFKRFM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol?
The IUPAC name of 1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol (CID 68820227) is 1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol.
What is the SMILES notation for 1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol?
The canonical SMILES for 1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol is CCc1cc(NC(C)O)nc(-c2cc(F)c(F)c(F)c2)n1.
What is the InChIKey of 1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol?
The InChIKey is FFEMXRJYVFKRFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3N3O/c1-3-9-6-12(18-7(2)21)20-14(19-9)8-4-10(15)13(17)11(16)5-8/h4-7,21H,3H2,1-2H3,(H,18,19,20).
What are the key properties of 1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol?
1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol has a molecular weight of 297.28 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[6-ethyl-2-(3,4,5-trifluorophenyl)pyrimidin-4-yl]amino]ethanol is sourced from PubChem (CID 68820227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).