C19H12BrF4N5O — CID 6882106
8-bromo-3-[(E)-[4-(dimethylamino)-2,3,5,6-tetrafluorophenyl]methylideneamino]-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 6882106) has the molecular formula C19H12BrF4N5O and a molecular weight of 482.24 g/mol. Its IUPAC name is 8-bromo-3-[(E)-[4-(dimethylamino)-2,3,5,6-tetrafluorophenyl]methylideneamino]-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 8-bromo-3-[(E)-[4-(dimethylamino)-2,3,5,6-tetrafluorophenyl]methylideneamino]-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 6882106 |
| Molecular Formula | C19H12BrF4N5O |
| Molecular Weight | 482.24 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | 8-bromo-3-[(E)-[4-(dimethylamino)-2,3,5,6-tetrafluorophenyl]methylideneamino]-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | CN(C)c1c(F)c(F)c(/C=N/n2cnc3c([nH]c4ccc(Br)cc43)c2=O)c(F)c1F |
| InChI | InChI=1S/C19H12BrF4N5O/c1-28(2)18-14(23)12(21)10(13(22)15(18)24)6-26-29-7-25-16-9-5-8(20)3-4-11(9)27-17(16)19(29)30/h3-7,27H,1-2H3/b26-6+ |
| InChIKey | NPKFKIXHICERGL-GOTRBWPWSA-N |
| XLogP | 4.14 |
| TPSA | 66.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.24 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|