C15H24N2O — CID 68821598
1-[(3-ethoxy-4-methylphenyl)methyl]piperidin-4-amine (PubChem CID 68821598) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[(3-ethoxy-4-methylphenyl)methyl]piperidin-4-amine.
| Compound Name | 1-[(3-ethoxy-4-methylphenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 68821598 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-[(3-ethoxy-4-methylphenyl)methyl]piperidin-4-amine |
| SMILES | CCOc1cc(CN2CCC(N)CC2)ccc1C |
| InChI | InChI=1S/C15H24N2O/c1-3-18-15-10-13(5-4-12(15)2)11-17-8-6-14(16)7-9-17/h4-5,10,14H,3,6-9,11,16H2,1-2H3 |
| InChIKey | VMPLCVHLWYADGR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |