About (3R,4R,5S)-4,5-diamino-3-hydroxycyclohexene-1-carboxylic acid
(3R,4R,5S)-4,5-diamino-3-hydroxycyclohexene-1-carboxylic acid (PubChem CID 68821914) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is (3R,4R,5S)-4,5-diamino-3-hydroxycyclohexene-1-carboxylic acid.
Analyze (3R,4R,5S)-4,5-diamino-3-hydroxycyclohexene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R,5S)-4,5-diamino-3-hydroxycyclohexene-1-carboxylic acid?
The IUPAC name of (3R,4R,5S)-4,5-diamino-3-hydroxycyclohexene-1-carboxylic acid (CID 68821914) is (3R,4R,5S)-4,5-diamino-3-hydroxycyclohexene-1-carboxylic acid.
What is the SMILES notation for (3R,4R,5S)-4,5-diamino-3-hydroxycyclohexene-1-carboxylic acid?
The canonical SMILES for (3R,4R,5S)-4,5-diamino-3-hydroxycyclohexene-1-carboxylic acid is N[C@H]1[C@H](O)C=C(C(=O)O)C[C@@H]1N.
What is the InChIKey of (3R,4R,5S)-4,5-diamino-3-hydroxycyclohexene-1-carboxylic acid?
The InChIKey is MDTPEUBXVBSCLM-KVQBGUIXSA-N. The full InChI is InChI=1S/C7H12N2O3/c8-4-1-3(7(11)12)2-5(10)6(4)9/h2,4-6,10H,1,8-9H2,(H,11,12)/t4-,5+,6+/m0/s1.
What are the key properties of (3R,4R,5S)-4,5-diamino-3-hydroxycyclohexene-1-carboxylic acid?
(3R,4R,5S)-4,5-diamino-3-hydroxycyclohexene-1-carboxylic acid has a molecular weight of 172.18 g/mol, XLogP of -1.58, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R,5S)-4,5-diamino-3-hydroxycyclohexene-1-carboxylic acid is sourced from PubChem (CID 68821914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).