About ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate
ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate (PubChem CID 68822721) has the molecular formula C26H26F3NO4
and a molecular weight of 473.49 g/mol. Its IUPAC name is ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate |
| PubChem CID | 68822721 |
| Molecular Formula | C26H26F3NO4 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1ccc2ccc(OCC(C)(C)CC#Cc3ccc(OC(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C26H26F3NO4/c1-4-32-24(31)17-30-15-13-20-9-12-22(16-23(20)30)33-18-25(2,3)14-5-6-19-7-10-21(11-8-19)34-26(27,28)29/h7-13,15-16H,4,14,17-18H2,1-3H3 |
| InChIKey | OHTNENFFMKLONR-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate?
The IUPAC name of ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate (CID 68822721) is ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate.
What is the SMILES notation for ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate?
The canonical SMILES for ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate is CCOC(=O)Cn1ccc2ccc(OCC(C)(C)CC#Cc3ccc(OC(F)(F)F)cc3)cc21.
What is the InChIKey of ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate?
The InChIKey is OHTNENFFMKLONR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26F3NO4/c1-4-32-24(31)17-30-15-13-20-9-12-22(16-23(20)30)33-18-25(2,3)14-5-6-19-7-10-21(11-8-19)34-26(27,28)29/h7-13,15-16H,4,14,17-18H2,1-3H3.
What are the key properties of ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate?
ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate has a molecular weight of 473.49 g/mol, XLogP of 5.95, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[6-[2,2-dimethyl-5-[4-(trifluoromethoxy)phenyl]pent-4-ynoxy]indol-1-yl]acetate is sourced from PubChem (CID 68822721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).