About 2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide
2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide (PubChem CID 68822891) has the molecular formula C14H24N4O3S2
and a molecular weight of 360.51 g/mol. Its IUPAC name is 2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide.
Molecular Properties
| Compound Name | 2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide |
| PubChem CID | 68822891 |
| Molecular Formula | C14H24N4O3S2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide |
| SMILES | Cc1cnc(N(C2CCN(C(C)C)CC2)S(=O)(=O)CC(N)=O)s1 |
| InChI | InChI=1S/C14H24N4O3S2/c1-10(2)17-6-4-12(5-7-17)18(14-16-8-11(3)22-14)23(20,21)9-13(15)19/h8,10,12H,4-7,9H2,1-3H3,(H2,15,19) |
| InChIKey | UGCXDRZYAAFLDH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide?
The IUPAC name of 2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide (CID 68822891) is 2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide.
What is the SMILES notation for 2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide?
The canonical SMILES for 2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide is Cc1cnc(N(C2CCN(C(C)C)CC2)S(=O)(=O)CC(N)=O)s1.
What is the InChIKey of 2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide?
The InChIKey is UGCXDRZYAAFLDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O3S2/c1-10(2)17-6-4-12(5-7-17)18(14-16-8-11(3)22-14)23(20,21)9-13(15)19/h8,10,12H,4-7,9H2,1-3H3,(H2,15,19).
What are the key properties of 2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide?
2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide has a molecular weight of 360.51 g/mol, XLogP of 0.95, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methyl-1,3-thiazol-2-yl)-(1-propan-2-ylpiperidin-4-yl)sulfamoyl]acetamide is sourced from PubChem (CID 68822891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).