C19H23F3N6O4 — CID 68823067
7-but-2-ynyl-2-methoxy-6-piperazin-1-yl-9-prop-2-enylpurin-8-one;2,2,2-trifluoroacetic acid (PubChem CID 68823067) has the molecular formula C19H23F3N6O4 and a molecular weight of 456.43 g/mol. Its IUPAC name is 7-but-2-ynyl-2-methoxy-6-piperazin-1-yl-9-prop-2-enylpurin-8-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-2-methoxy-6-piperazin-1-yl-9-prop-2-enylpurin-8-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68823067 |
| Molecular Formula | C19H23F3N6O4 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 7-but-2-ynyl-2-methoxy-6-piperazin-1-yl-9-prop-2-enylpurin-8-one;2,2,2-trifluoroacetic acid |
| SMILES | C=CCn1c(=O)n(CC#CC)c2c(N3CCNCC3)nc(OC)nc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N6O2.C2HF3O2/c1-4-6-10-22-13-14(21-11-7-18-8-12-21)19-16(25-3)20-15(13)23(9-5-2)17(22)24;3-2(4,5)1(6)7/h5,18H,2,7-12H2,1,3H3;(H,6,7) |
| InChIKey | WMOCSSQAGDMINW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|