C20H27N3O5 — CID 68823305
6-[(1-amino-2-methyl-9H-carbazol-4-yl)-methylamino]hexane-1,2,3,4,5-pentol (PubChem CID 68823305) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 6-[(1-amino-2-methyl-9H-carbazol-4-yl)-methylamino]hexane-1,2,3,4,5-pentol.
| Compound Name | 6-[(1-amino-2-methyl-9H-carbazol-4-yl)-methylamino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 68823305 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 6-[(1-amino-2-methyl-9H-carbazol-4-yl)-methylamino]hexane-1,2,3,4,5-pentol |
| SMILES | Cc1cc(N(C)CC(O)C(O)C(O)C(O)CO)c2c([nH]c3ccccc32)c1N |
| InChI | InChI=1S/C20H27N3O5/c1-10-7-13(23(2)8-14(25)19(27)20(28)15(26)9-24)16-11-5-3-4-6-12(11)22-18(16)17(10)21/h3-7,14-15,19-20,22,24-28H,8-9,21H2,1-2H3 |
| InChIKey | UGWMWLXIAUQCFD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|