About [(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate
[(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate (PubChem CID 68823431) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate.
Molecular Properties
| Compound Name | [(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate |
| PubChem CID | 68823431 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | [(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate |
| SMILES | CN(Cc1ccccc1)C(=O)O[C@H]1CCCO1 |
| InChI | InChI=1S/C13H17NO3/c1-14(10-11-6-3-2-4-7-11)13(15)17-12-8-5-9-16-12/h2-4,6-7,12H,5,8-10H2,1H3/t12-/m0/s1 |
| InChIKey | CMMGMRYEZSKJBF-LBPRGKRZSA-N |
| XLogP | 2.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate?
The IUPAC name of [(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate (CID 68823431) is [(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate.
What is the SMILES notation for [(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate?
The canonical SMILES for [(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate is CN(Cc1ccccc1)C(=O)O[C@H]1CCCO1.
What is the InChIKey of [(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate?
The InChIKey is CMMGMRYEZSKJBF-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H17NO3/c1-14(10-11-6-3-2-4-7-11)13(15)17-12-8-5-9-16-12/h2-4,6-7,12H,5,8-10H2,1H3/t12-/m0/s1.
What are the key properties of [(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate?
[(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate has a molecular weight of 235.28 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-oxolan-2-yl] N-benzyl-N-methylcarbamate is sourced from PubChem (CID 68823431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).