About 9-methylcarbazole-1,2,7,8-tetramine
9-methylcarbazole-1,2,7,8-tetramine (PubChem CID 68823489) has the molecular formula C13H15N5
and a molecular weight of 241.30 g/mol. Its IUPAC name is 9-methylcarbazole-1,2,7,8-tetramine.
Molecular Properties
| Compound Name | 9-methylcarbazole-1,2,7,8-tetramine |
| PubChem CID | 68823489 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 9-methylcarbazole-1,2,7,8-tetramine |
| SMILES | Cn1c2c(N)c(N)ccc2c2ccc(N)c(N)c21 |
| InChI | InChI=1S/C13H15N5/c1-18-12-6(2-4-8(14)10(12)16)7-3-5-9(15)11(17)13(7)18/h2-5H,14-17H2,1H3 |
| InChIKey | NWZPIUPZGWQRCD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 109.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-methylcarbazole-1,2,7,8-tetramine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylcarbazole-1,2,7,8-tetramine?
The IUPAC name of 9-methylcarbazole-1,2,7,8-tetramine (CID 68823489) is 9-methylcarbazole-1,2,7,8-tetramine.
What is the SMILES notation for 9-methylcarbazole-1,2,7,8-tetramine?
The canonical SMILES for 9-methylcarbazole-1,2,7,8-tetramine is Cn1c2c(N)c(N)ccc2c2ccc(N)c(N)c21.
What is the InChIKey of 9-methylcarbazole-1,2,7,8-tetramine?
The InChIKey is NWZPIUPZGWQRCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5/c1-18-12-6(2-4-8(14)10(12)16)7-3-5-9(15)11(17)13(7)18/h2-5H,14-17H2,1H3.
What are the key properties of 9-methylcarbazole-1,2,7,8-tetramine?
9-methylcarbazole-1,2,7,8-tetramine has a molecular weight of 241.30 g/mol, XLogP of 1.66, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylcarbazole-1,2,7,8-tetramine is sourced from PubChem (CID 68823489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).