2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid

C11H10FNO3 — CID 68823752

IUPAC2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid
SMILESC=C(NC(=O)C(F)c1ccccc1)C(=O)O
InChIInChI=1S/C11H10FNO3/c1-7(11(15)16)13-10(14)9(12)8-5-3-2-4-6-8/h2-6,9H,1H2,(H,13,14)(H,15,16)
InChIKeyMQYCPRDQQMCDGD-UHFFFAOYSA-N
MW223.20 g/mol
LogP1.41
Rot. Bonds4

About 2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid

2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid (PubChem CID 68823752) has the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. Its IUPAC name is 2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid.

Molecular Properties

Compound Name2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid
PubChem CID68823752
Molecular FormulaC11H10FNO3
Molecular Weight223.20 g/mol
Exact Mass223.06
IUPAC Name2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid
SMILESC=C(NC(=O)C(F)c1ccccc1)C(=O)O
InChIInChI=1S/C11H10FNO3/c1-7(11(15)16)13-10(14)9(12)8-5-3-2-4-6-8/h2-6,9H,1H2,(H,13,14)(H,15,16)
InChIKeyMQYCPRDQQMCDGD-UHFFFAOYSA-N
XLogP1.41
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.20
LogP ≤ 51.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid?
The IUPAC name of 2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid (CID 68823752) is 2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid.
What is the SMILES notation for 2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid?
The canonical SMILES for 2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid is C=C(NC(=O)C(F)c1ccccc1)C(=O)O.
What is the InChIKey of 2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid?
The InChIKey is MQYCPRDQQMCDGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO3/c1-7(11(15)16)13-10(14)9(12)8-5-3-2-4-6-8/h2-6,9H,1H2,(H,13,14)(H,15,16).
What are the key properties of 2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid?
2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid has a molecular weight of 223.20 g/mol, XLogP of 1.41, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-fluoro-2-phenylacetyl)amino]prop-2-enoic acid is sourced from PubChem (CID 68823752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).