About [2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol
[2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol (PubChem CID 688238) has the molecular formula C11H16S2
and a molecular weight of 212.38 g/mol. Its IUPAC name is [2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol.
Molecular Properties
| Compound Name | [2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol |
| PubChem CID | 688238 |
| Molecular Formula | C11H16S2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | [2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol |
| SMILES | Cc1cc(C)c(CS)c(C)c1CS |
| InChI | InChI=1S/C11H16S2/c1-7-4-8(2)11(6-13)9(3)10(7)5-12/h4,12-13H,5-6H2,1-3H3 |
| InChIKey | FDLRLJPEBZYMMO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol?
The IUPAC name of [2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol (CID 688238) is [2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol.
What is the SMILES notation for [2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol?
The canonical SMILES for [2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol is Cc1cc(C)c(CS)c(C)c1CS.
What is the InChIKey of [2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol?
The InChIKey is FDLRLJPEBZYMMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16S2/c1-7-4-8(2)11(6-13)9(3)10(7)5-12/h4,12-13H,5-6H2,1-3H3.
What are the key properties of [2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol?
[2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol has a molecular weight of 212.38 g/mol, XLogP of 3.47, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4,6-trimethyl-3-(sulfanylmethyl)phenyl]methanethiol is sourced from PubChem (CID 688238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).