About 6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile
6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile (PubChem CID 68823887) has the molecular formula C10H12N2O4
and a molecular weight of 224.22 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile |
| PubChem CID | 68823887 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile |
| SMILES | COCCOC1([N+](=O)[O-])C=CC=CC1C#N |
| InChI | InChI=1S/C10H12N2O4/c1-15-6-7-16-10(12(13)14)5-3-2-4-9(10)8-11/h2-5,9H,6-7H2,1H3 |
| InChIKey | IWVXJNSLQOSJOE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile?
The IUPAC name of 6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile (CID 68823887) is 6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile.
What is the SMILES notation for 6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile?
The canonical SMILES for 6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile is COCCOC1([N+](=O)[O-])C=CC=CC1C#N.
What is the InChIKey of 6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile?
The InChIKey is IWVXJNSLQOSJOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4/c1-15-6-7-16-10(12(13)14)5-3-2-4-9(10)8-11/h2-5,9H,6-7H2,1H3.
What are the key properties of 6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile?
6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile has a molecular weight of 224.22 g/mol, XLogP of 0.89, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methoxyethoxy)-6-nitrocyclohexa-2,4-diene-1-carbonitrile is sourced from PubChem (CID 68823887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).