C14H17N3O2 — CID 68823981
6-nitro-2-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 68823981) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 6-nitro-2-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 6-nitro-2-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 68823981 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 6-nitro-2-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC(C)N1CCc2c([nH]c3ccc([N+](=O)[O-])cc23)C1 |
| InChI | InChI=1S/C14H17N3O2/c1-9(2)16-6-5-11-12-7-10(17(18)19)3-4-13(12)15-14(11)8-16/h3-4,7,9,15H,5-6,8H2,1-2H3 |
| InChIKey | UPUKFYZENXLQJJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|