C34H43N5O2 — CID 68824398
1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[2-[(1-hept-2-ynoylpiperidin-4-yl)methyl]phenyl]urea (PubChem CID 68824398) has the molecular formula C34H43N5O2 and a molecular weight of 553.75 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[2-[(1-hept-2-ynoylpiperidin-4-yl)methyl]phenyl]urea.
| Compound Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[2-[(1-hept-2-ynoylpiperidin-4-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 68824398 |
| Molecular Formula | C34H43N5O2 |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[2-[(1-hept-2-ynoylpiperidin-4-yl)methyl]phenyl]urea |
| SMILES | CCCCC#CC(=O)N1CCC(Cc2ccccc2NC(=O)Nc2cc(C(C)(C)C)nn2-c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C34H43N5O2/c1-6-7-8-9-14-32(40)38-21-19-26(20-22-38)23-27-12-10-11-13-29(27)35-33(41)36-31-24-30(34(3,4)5)37-39(31)28-17-15-25(2)16-18-28/h10-13,15-18,24,26H,6-8,19-23H2,1-5H3,(H2,35,36,41) |
| InChIKey | GEYVADIYHSQUJZ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|