About 4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine
4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine (PubChem CID 68824484) has the molecular formula C17H15N3S
and a molecular weight of 293.39 g/mol. Its IUPAC name is 4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine |
| PubChem CID | 68824484 |
| Molecular Formula | C17H15N3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine |
| SMILES | Nc1ccc(NCc2ccsc2)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C17H15N3S/c18-13-5-6-15(19-9-11-7-8-21-10-11)16-12-3-1-2-4-14(12)20-17(13)16/h1-8,10,19-20H,9,18H2 |
| InChIKey | ZOQSMKJVXPIXJM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine?
The IUPAC name of 4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine (CID 68824484) is 4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine.
What is the SMILES notation for 4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine?
The canonical SMILES for 4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine is Nc1ccc(NCc2ccsc2)c2c1[nH]c1ccccc12.
What is the InChIKey of 4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine?
The InChIKey is ZOQSMKJVXPIXJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3S/c18-13-5-6-15(19-9-11-7-8-21-10-11)16-12-3-1-2-4-14(12)20-17(13)16/h1-8,10,19-20H,9,18H2.
What are the key properties of 4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine?
4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine has a molecular weight of 293.39 g/mol, XLogP of 4.58, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(thiophen-3-ylmethyl)-9H-carbazole-1,4-diamine is sourced from PubChem (CID 68824484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).