C34H40N6O3 — CID 68824877
1-[4-[[1-(3-amino-4-hydroxybenzoyl)piperidin-4-yl]methyl]phenyl]-3-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]urea (PubChem CID 68824877) has the molecular formula C34H40N6O3 and a molecular weight of 580.73 g/mol. Its IUPAC name is 1-[4-[[1-(3-amino-4-hydroxybenzoyl)piperidin-4-yl]methyl]phenyl]-3-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]urea.
| Compound Name | 1-[4-[[1-(3-amino-4-hydroxybenzoyl)piperidin-4-yl]methyl]phenyl]-3-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 68824877 |
| Molecular Formula | C34H40N6O3 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | 1-[4-[[1-(3-amino-4-hydroxybenzoyl)piperidin-4-yl]methyl]phenyl]-3-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]urea |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(CC3CCN(C(=O)c4ccc(O)c(N)c4)CC3)cc2)cc1 |
| InChI | InChI=1S/C34H40N6O3/c1-22-5-12-27(13-6-22)40-31(21-30(38-40)34(2,3)4)37-33(43)36-26-10-7-23(8-11-26)19-24-15-17-39(18-16-24)32(42)25-9-14-29(41)28(35)20-25/h5-14,20-21,24,41H,15-19,35H2,1-4H3,(H2,36,37,43) |
| InChIKey | JHSDLPCMWBCQTD-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 125.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|