About 2,5-dihydro-1H-pyrrolo[3,4-b]pyridine
2,5-dihydro-1H-pyrrolo[3,4-b]pyridine (PubChem CID 68824908) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 2,5-dihydro-1H-pyrrolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 2,5-dihydro-1H-pyrrolo[3,4-b]pyridine |
| PubChem CID | 68824908 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 2,5-dihydro-1H-pyrrolo[3,4-b]pyridine |
| SMILES | C1=CC2=C(C=NC2)NC1 |
| InChI | InChI=1S/C7H8N2/c1-2-6-4-8-5-7(6)9-3-1/h1-2,5,9H,3-4H2 |
| InChIKey | LNULQONSGFLJTD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dihydro-1H-pyrrolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dihydro-1H-pyrrolo[3,4-b]pyridine?
The IUPAC name of 2,5-dihydro-1H-pyrrolo[3,4-b]pyridine (CID 68824908) is 2,5-dihydro-1H-pyrrolo[3,4-b]pyridine.
What is the SMILES notation for 2,5-dihydro-1H-pyrrolo[3,4-b]pyridine?
The canonical SMILES for 2,5-dihydro-1H-pyrrolo[3,4-b]pyridine is C1=CC2=C(C=NC2)NC1.
What is the InChIKey of 2,5-dihydro-1H-pyrrolo[3,4-b]pyridine?
The InChIKey is LNULQONSGFLJTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c1-2-6-4-8-5-7(6)9-3-1/h1-2,5,9H,3-4H2.
What are the key properties of 2,5-dihydro-1H-pyrrolo[3,4-b]pyridine?
2,5-dihydro-1H-pyrrolo[3,4-b]pyridine has a molecular weight of 120.15 g/mol, XLogP of 0.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydro-1H-pyrrolo[3,4-b]pyridine is sourced from PubChem (CID 68824908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).