C22H31N5OS — CID 68824977
[4-(6-cyclobutyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-yl)piperidin-1-yl]-(1,4-dimethylpyrazol-3-yl)methanone (PubChem CID 68824977) has the molecular formula C22H31N5OS and a molecular weight of 413.59 g/mol. Its IUPAC name is [4-(6-cyclobutyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-yl)piperidin-1-yl]-(1,4-dimethylpyrazol-3-yl)methanone.
| Compound Name | [4-(6-cyclobutyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-yl)piperidin-1-yl]-(1,4-dimethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 68824977 |
| Molecular Formula | C22H31N5OS |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | [4-(6-cyclobutyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-2-yl)piperidin-1-yl]-(1,4-dimethylpyrazol-3-yl)methanone |
| SMILES | Cc1cn(C)nc1C(=O)N1CCC(c2nc3c(s2)CCN(C2CCC2)CC3)CC1 |
| InChI | InChI=1S/C22H31N5OS/c1-15-14-25(2)24-20(15)22(28)27-10-6-16(7-11-27)21-23-18-8-12-26(17-4-3-5-17)13-9-19(18)29-21/h14,16-17H,3-13H2,1-2H3 |
| InChIKey | LZCVMFHNCFEQBN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |