C14H15N3O — CID 68825203
2-(3,4-diaminocarbazol-9-yl)ethanol (PubChem CID 68825203) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-(3,4-diaminocarbazol-9-yl)ethanol.
| Compound Name | 2-(3,4-diaminocarbazol-9-yl)ethanol |
|---|---|
| PubChem CID | 68825203 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-(3,4-diaminocarbazol-9-yl)ethanol |
| SMILES | Nc1ccc2c(c1N)c1ccccc1n2CCO |
| InChI | InChI=1S/C14H15N3O/c15-10-5-6-12-13(14(10)16)9-3-1-2-4-11(9)17(12)7-8-18/h1-6,18H,7-8,15-16H2 |
| InChIKey | DVUHKDFAXXSZHE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|