About methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate
methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate (PubChem CID 68825237) has the molecular formula C13H24O5
and a molecular weight of 260.33 g/mol. Its IUPAC name is methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate |
| PubChem CID | 68825237 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate |
| SMILES | COC(=O)C[C@](O)(C(C)C)C1CCOC(C)(C)O1 |
| InChI | InChI=1S/C13H24O5/c1-9(2)13(15,8-11(14)16-5)10-6-7-17-12(3,4)18-10/h9-10,15H,6-8H2,1-5H3/t10?,13-/m0/s1 |
| InChIKey | GDTDWIZCKVFHID-HQVZTVAUSA-N |
| XLogP | 1.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate?
The IUPAC name of methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate (CID 68825237) is methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate.
What is the SMILES notation for methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate?
The canonical SMILES for methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate is COC(=O)C[C@](O)(C(C)C)C1CCOC(C)(C)O1.
What is the InChIKey of methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate?
The InChIKey is GDTDWIZCKVFHID-HQVZTVAUSA-N. The full InChI is InChI=1S/C13H24O5/c1-9(2)13(15,8-11(14)16-5)10-6-7-17-12(3,4)18-10/h9-10,15H,6-8H2,1-5H3/t10?,13-/m0/s1.
What are the key properties of methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate?
methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate has a molecular weight of 260.33 g/mol, XLogP of 1.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-(2,2-dimethyl-1,3-dioxan-4-yl)-3-hydroxy-4-methylpentanoate is sourced from PubChem (CID 68825237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).