About 3-methoxydibenzofuran-1,4-diamine
3-methoxydibenzofuran-1,4-diamine (PubChem CID 68825275) has the molecular formula C13H12N2O2
and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-methoxydibenzofuran-1,4-diamine.
Molecular Properties
| Compound Name | 3-methoxydibenzofuran-1,4-diamine |
| PubChem CID | 68825275 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-methoxydibenzofuran-1,4-diamine |
| SMILES | COc1cc(N)c2c(oc3ccccc32)c1N |
| InChI | InChI=1S/C13H12N2O2/c1-16-10-6-8(14)11-7-4-2-3-5-9(7)17-13(11)12(10)15/h2-6H,14-15H2,1H3 |
| InChIKey | VEDXJRUGYATSSD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxydibenzofuran-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxydibenzofuran-1,4-diamine?
The IUPAC name of 3-methoxydibenzofuran-1,4-diamine (CID 68825275) is 3-methoxydibenzofuran-1,4-diamine.
What is the SMILES notation for 3-methoxydibenzofuran-1,4-diamine?
The canonical SMILES for 3-methoxydibenzofuran-1,4-diamine is COc1cc(N)c2c(oc3ccccc32)c1N.
What is the InChIKey of 3-methoxydibenzofuran-1,4-diamine?
The InChIKey is VEDXJRUGYATSSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2/c1-16-10-6-8(14)11-7-4-2-3-5-9(7)17-13(11)12(10)15/h2-6H,14-15H2,1H3.
What are the key properties of 3-methoxydibenzofuran-1,4-diamine?
3-methoxydibenzofuran-1,4-diamine has a molecular weight of 228.25 g/mol, XLogP of 2.76, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxydibenzofuran-1,4-diamine is sourced from PubChem (CID 68825275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).