About [5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol
[5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol (PubChem CID 68825277) has the molecular formula C8H8F3NO2
and a molecular weight of 207.15 g/mol. Its IUPAC name is [5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol.
Molecular Properties
| Compound Name | [5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol |
| PubChem CID | 68825277 |
| Molecular Formula | C8H8F3NO2 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | [5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol |
| SMILES | OCc1ccc(OC(F)C(F)F)cn1 |
| InChI | InChI=1S/C8H8F3NO2/c9-7(10)8(11)14-6-2-1-5(4-13)12-3-6/h1-3,7-8,13H,4H2 |
| InChIKey | GPEOYVMFADSRHI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol?
The IUPAC name of [5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol (CID 68825277) is [5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol.
What is the SMILES notation for [5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol?
The canonical SMILES for [5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol is OCc1ccc(OC(F)C(F)F)cn1.
What is the InChIKey of [5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol?
The InChIKey is GPEOYVMFADSRHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NO2/c9-7(10)8(11)14-6-2-1-5(4-13)12-3-6/h1-3,7-8,13H,4H2.
What are the key properties of [5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol?
[5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol has a molecular weight of 207.15 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1,2,2-trifluoroethoxy)-2-pyridinyl]methanol is sourced from PubChem (CID 68825277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).