About azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene
azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene (PubChem CID 68825933) has the molecular formula C12H18ClN
and a molecular weight of 211.74 g/mol. Its IUPAC name is azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene.
Molecular Properties
| Compound Name | azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene |
| PubChem CID | 68825933 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene |
| SMILES | C=CCc1c(CCl)ccc(C)c1C.N |
| InChI | InChI=1S/C12H15Cl.H3N/c1-4-5-12-10(3)9(2)6-7-11(12)8-13;/h4,6-7H,1,5,8H2,2-3H3;1H3 |
| InChIKey | BVJOCLBQEYWUGV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene?
The IUPAC name of azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene (CID 68825933) is azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene.
What is the SMILES notation for azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene?
The canonical SMILES for azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene is C=CCc1c(CCl)ccc(C)c1C.N.
What is the InChIKey of azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene?
The InChIKey is BVJOCLBQEYWUGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl.H3N/c1-4-5-12-10(3)9(2)6-7-11(12)8-13;/h4,6-7H,1,5,8H2,2-3H3;1H3.
What are the key properties of azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene?
azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene has a molecular weight of 211.74 g/mol, XLogP of 3.93, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-(chloromethyl)-3,4-dimethyl-2-prop-2-enylbenzene is sourced from PubChem (CID 68825933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).