About 2-(dichloromethyl)-3,4-di(propan-2-yl)borete
2-(dichloromethyl)-3,4-di(propan-2-yl)borete (PubChem CID 68827435) has the molecular formula C10H15BCl2
and a molecular weight of 216.95 g/mol. Its IUPAC name is 2-(dichloromethyl)-3,4-di(propan-2-yl)borete.
Molecular Properties
| Compound Name | 2-(dichloromethyl)-3,4-di(propan-2-yl)borete |
| PubChem CID | 68827435 |
| Molecular Formula | C10H15BCl2 |
| Molecular Weight | 216.95 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-(dichloromethyl)-3,4-di(propan-2-yl)borete |
| SMILES | CC(C)C1=C(C(C)C)C(C(Cl)Cl)=B1 |
| InChI | InChI=1S/C10H15BCl2/c1-5(2)7-8(6(3)4)11-9(7)10(12)13/h5-6,10H,1-4H3 |
| InChIKey | WQFBXTLHYKDYFB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.95 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(dichloromethyl)-3,4-di(propan-2-yl)borete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dichloromethyl)-3,4-di(propan-2-yl)borete?
The IUPAC name of 2-(dichloromethyl)-3,4-di(propan-2-yl)borete (CID 68827435) is 2-(dichloromethyl)-3,4-di(propan-2-yl)borete.
What is the SMILES notation for 2-(dichloromethyl)-3,4-di(propan-2-yl)borete?
The canonical SMILES for 2-(dichloromethyl)-3,4-di(propan-2-yl)borete is CC(C)C1=C(C(C)C)C(C(Cl)Cl)=B1.
What is the InChIKey of 2-(dichloromethyl)-3,4-di(propan-2-yl)borete?
The InChIKey is WQFBXTLHYKDYFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BCl2/c1-5(2)7-8(6(3)4)11-9(7)10(12)13/h5-6,10H,1-4H3.
What are the key properties of 2-(dichloromethyl)-3,4-di(propan-2-yl)borete?
2-(dichloromethyl)-3,4-di(propan-2-yl)borete has a molecular weight of 216.95 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dichloromethyl)-3,4-di(propan-2-yl)borete is sourced from PubChem (CID 68827435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).