C24H17F3N4O5 — CID 68827655
[(3R)-3-(4-nitrophenyl)-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)-1,4-benzodiazepin-3-yl] carbamate (PubChem CID 68827655) has the molecular formula C24H17F3N4O5 and a molecular weight of 498.42 g/mol. Its IUPAC name is [(3R)-3-(4-nitrophenyl)-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)-1,4-benzodiazepin-3-yl] carbamate.
| Compound Name | [(3R)-3-(4-nitrophenyl)-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)-1,4-benzodiazepin-3-yl] carbamate |
|---|---|
| PubChem CID | 68827655 |
| Molecular Formula | C24H17F3N4O5 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | [(3R)-3-(4-nitrophenyl)-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)-1,4-benzodiazepin-3-yl] carbamate |
| SMILES | NC(=O)O[C@@]1(c2ccc([N+](=O)[O-])cc2)N=C(c2ccccc2)c2ccccc2N(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C24H17F3N4O5/c25-23(26,27)14-30-19-9-5-4-8-18(19)20(15-6-2-1-3-7-15)29-24(21(30)32,36-22(28)33)16-10-12-17(13-11-16)31(34)35/h1-13H,14H2,(H2,28,33)/t24-/m1/s1 |
| InChIKey | JLUIHJWJXPAHRU-XMMPIXPASA-N |
| XLogP | 4.29 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|