C26H18N4O2 — CID 6882767
3-[(E)-anthracen-9-ylmethylideneamino]-8-methyl-1,5-dihydropyrimido[5,4-b]indole-2,4-dione (PubChem CID 6882767) has the molecular formula C26H18N4O2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 3-[(E)-anthracen-9-ylmethylideneamino]-8-methyl-1,5-dihydropyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 3-[(E)-anthracen-9-ylmethylideneamino]-8-methyl-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 6882767 |
| Molecular Formula | C26H18N4O2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 3-[(E)-anthracen-9-ylmethylideneamino]-8-methyl-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| SMILES | Cc1ccc2[nH]c3c(=O)n(/N=C/c4c5ccccc5cc5ccccc45)c(=O)[nH]c3c2c1 |
| InChI | InChI=1S/C26H18N4O2/c1-15-10-11-22-20(12-15)23-24(28-22)25(31)30(26(32)29-23)27-14-21-18-8-4-2-6-16(18)13-17-7-3-5-9-19(17)21/h2-14,28H,1H3,(H,29,32)/b27-14+ |
| InChIKey | QBLXSPKHMZXHCP-MZJWZYIUSA-N |
| XLogP | 4.67 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|