C26H29ClF2N3O7PS — CID 68827759
[2-[3-[3-chloro-5-(3-ethylsulfonylphenyl)pyrido[2,3-b]indol-9-yl]oxypropyl-ethylamino]-2,2-difluoroethyl] dihydrogen phosphate (PubChem CID 68827759) has the molecular formula C26H29ClF2N3O7PS and a molecular weight of 632.02 g/mol. Its IUPAC name is [2-[3-[3-chloro-5-(3-ethylsulfonylphenyl)pyrido[2,3-b]indol-9-yl]oxypropyl-ethylamino]-2,2-difluoroethyl] dihydrogen phosphate.
| Compound Name | [2-[3-[3-chloro-5-(3-ethylsulfonylphenyl)pyrido[2,3-b]indol-9-yl]oxypropyl-ethylamino]-2,2-difluoroethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 68827759 |
| Molecular Formula | C26H29ClF2N3O7PS |
| Molecular Weight | 632.02 g/mol |
| Exact Mass | 631.11 |
| IUPAC Name | [2-[3-[3-chloro-5-(3-ethylsulfonylphenyl)pyrido[2,3-b]indol-9-yl]oxypropyl-ethylamino]-2,2-difluoroethyl] dihydrogen phosphate |
| SMILES | CCN(CCCOn1c2cccc(-c3cccc(S(=O)(=O)CC)c3)c2c2cc(Cl)cnc21)C(F)(F)COP(=O)(O)O |
| InChI | InChI=1S/C26H29ClF2N3O7PS/c1-3-31(26(28,29)17-39-40(33,34)35)12-7-13-38-32-23-11-6-10-21(24(23)22-15-19(27)16-30-25(22)32)18-8-5-9-20(14-18)41(36,37)4-2/h5-6,8-11,14-16H,3-4,7,12-13,17H2,1-2H3,(H2,33,34,35) |
| InChIKey | JUWKHKNXHJWJEV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.02 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|