C18H15NO4 — CID 68827772
14-methyl-5,7,11-trioxa-14-azapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-2,4(8),9,16,18,20-hexaen-15-one (PubChem CID 68827772) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 14-methyl-5,7,11-trioxa-14-azapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-2,4(8),9,16,18,20-hexaen-15-one.
| Compound Name | 14-methyl-5,7,11-trioxa-14-azapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-2,4(8),9,16,18,20-hexaen-15-one |
|---|---|
| PubChem CID | 68827772 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 14-methyl-5,7,11-trioxa-14-azapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-2,4(8),9,16,18,20-hexaen-15-one |
| SMILES | CN1C(=O)c2ccccc2C2c3cc4c(cc3OCC21)OCO4 |
| InChI | InChI=1S/C18H15NO4/c1-19-13-8-21-14-7-16-15(22-9-23-16)6-12(14)17(13)10-4-2-3-5-11(10)18(19)20/h2-7,13,17H,8-9H2,1H3 |
| InChIKey | VYAUGDIEILQQQL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |